(R)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID

(R)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID - Names and Identifiers

Name	(R)-4-Amino-3-(4-fluorophenyl)butanoic acid
Synonyms	(R)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID (R)-4-Amino-3-(4-fluorophenyl)butanoic acid (3R)-4-Amino-3-(4-fluorophenyl)butanoic acid benzenepropanoic acid, β-(aminomethyl)-4-fluoro-, (betaR)- Benzenepropanoic acid, β-(aminomethyl)-4-fluoro-, (R)- (9CI)
CAS	741217-33-4
InChI	InChI=1/C10H12FNO2/c11-9-3-1-7(2-4-9)8(6-12)5-10(13)14/h1-4,8H,5-6,12H2,(H,13,14)/t8-/m0/s1

(R)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID - Physico-chemical Properties

Molecular Formula	C10H12FNO2
Molar Mass	197.21
Density	1.244±0.06 g/cm3(Predicted)
Boling Point	329.1±32.0 °C(Predicted)
Flash Point	152.9°C
Vapor Presure	7.28E-05mmHg at 25°C
pKa	4.08±0.10(Predicted)
Storage Condition	under inert gas (nitrogen or Argon) at 2–8 °C
Refractive Index	1.545

(R)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID - Introduction

(R)-4-Amino-3-(4-fluorophenyl)butanoic acid is an organic compound with the chemical formula C10H12FNO2. It is a chiral molecule with an (R) configuration. Its nature is as follows:

1. appearance: powder or crystalline solid.
2. Solubility: Soluble in some organic solvents, such as ethanol, chloroform and dimethyl sulfoxide.
3. melting point: about 150-155 degrees Celsius.

(R)-4-Amino-3-(4-fluorophenyl)butanoic acid has certain applications in the field of medicine, mainly as a selective γ-aminobutyric acid (GABA) transaminase inhibitor. Its inhibition of GABA transaminase is useful in the treatment of neurological disorders such as epilepsy and anxiety disorders.

Preparation of (R)-4-Amino-3-(4-fluorophenyl)butanoic acid A commonly used method is to synthesize it through a corresponding reaction under acid catalysis. The specific synthesis method can refer to the relevant organic synthesis literature.

Note the following safety information when using and storing (R)-4-Amino-3-(4-fluorophenyl)butanoic acid:

1. Avoid contact with skin and eyes. In case of accidental contact, rinse immediately with plenty of water and seek medical help.
2. Use should wear appropriate protective equipment, such as chemical protective gloves and goggles.
3. Operate in a well-ventilated place to avoid inhaling aerosols or dust.
4. storage should be sealed, away from the fire and combustible items.

Last Update：2024-04-09 21:21:28